C7H9ClO — CID 130908196
(1R,5S,6S,7R)-7-chlorobicyclo[3.2.0]hept-2-en-6-ol (PubChem CID 130908196) has the molecular formula C7H9ClO and a molecular weight of 144.60 g/mol. Its IUPAC name is (1R,5S,6S,7R)-7-chlorobicyclo[3.2.0]hept-2-en-6-ol.
| Compound Name | (1R,5S,6S,7R)-7-chlorobicyclo[3.2.0]hept-2-en-6-ol |
|---|---|
| PubChem CID | 130908196 |
| Molecular Formula | C7H9ClO |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.03 |
| IUPAC Name | (1R,5S,6S,7R)-7-chlorobicyclo[3.2.0]hept-2-en-6-ol |
| SMILES | O[C@@H]1[C@H](Cl)[C@@H]2C=CC[C@H]12 |
| InChI | InChI=1S/C7H9ClO/c8-6-4-2-1-3-5(4)7(6)9/h1-2,4-7,9H,3H2/t4-,5+,6-,7+/m1/s1 |
| InChIKey | BEPJRTOKPLRSOE-UCROKIRRSA-N |
| XLogP | 1.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|