C7H8Cl2O — CID 11298288
(1R,5S,6R)-7,7-dichlorobicyclo[3.2.0]hept-2-en-6-ol (PubChem CID 11298288) has the molecular formula C7H8Cl2O and a molecular weight of 179.05 g/mol. Its IUPAC name is (1R,5S,6R)-7,7-dichlorobicyclo[3.2.0]hept-2-en-6-ol.
| Compound Name | (1R,5S,6R)-7,7-dichlorobicyclo[3.2.0]hept-2-en-6-ol |
|---|---|
| PubChem CID | 11298288 |
| Molecular Formula | C7H8Cl2O |
| Molecular Weight | 179.05 g/mol |
| Exact Mass | 178.00 |
| IUPAC Name | (1R,5S,6R)-7,7-dichlorobicyclo[3.2.0]hept-2-en-6-ol |
| SMILES | O[C@@H]1[C@H]2CC=C[C@H]2C1(Cl)Cl |
| InChI | InChI=1S/C7H8Cl2O/c8-7(9)5-3-1-2-4(5)6(7)10/h1,3-6,10H,2H2/t4-,5+,6+/m0/s1 |
| InChIKey | KABGHGOJIFFLJD-KVQBGUIXSA-N |
| XLogP | 1.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.05 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|