C8H11ClO — CID 14162154
(1R,6S,7S,8S)-8-chlorobicyclo[4.2.0]oct-2-en-7-ol (PubChem CID 14162154) has the molecular formula C8H11ClO and a molecular weight of 158.63 g/mol. Its IUPAC name is (1R,6S,7S,8S)-8-chlorobicyclo[4.2.0]oct-2-en-7-ol.
| Compound Name | (1R,6S,7S,8S)-8-chlorobicyclo[4.2.0]oct-2-en-7-ol |
|---|---|
| PubChem CID | 14162154 |
| Molecular Formula | C8H11ClO |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | (1R,6S,7S,8S)-8-chlorobicyclo[4.2.0]oct-2-en-7-ol |
| SMILES | O[C@@H]1[C@@H](Cl)[C@@H]2C=CCC[C@H]12 |
| InChI | InChI=1S/C8H11ClO/c9-7-5-3-1-2-4-6(5)8(7)10/h1,3,5-8,10H,2,4H2/t5-,6+,7+,8+/m1/s1 |
| InChIKey | ALCBDQMLFOGWEZ-KVPKETBZSA-N |
| XLogP | 1.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|