C14H25ClO — CID 135040007
(2R)-1-chloro-4-[(6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol (PubChem CID 135040007) has the molecular formula C14H25ClO and a molecular weight of 244.81 g/mol. Its IUPAC name is (2R)-1-chloro-4-[(6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol.
| Compound Name | (2R)-1-chloro-4-[(6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol |
|---|---|
| PubChem CID | 135040007 |
| Molecular Formula | C14H25ClO |
| Molecular Weight | 244.81 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (2R)-1-chloro-4-[(6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]butan-2-ol |
| SMILES | CC(C)C1C=C(CC[C@@H](O)CCl)[C@H](C)CC1 |
| InChI | InChI=1S/C14H25ClO/c1-10(2)12-5-4-11(3)13(8-12)6-7-14(16)9-15/h8,10-12,14,16H,4-7,9H2,1-3H3/t11-,12?,14-/m1/s1 |
| InChIKey | VWJSVWFVJZULMW-YXHCSQSYSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|