C12H20ClFO — CID 153333915
4-chloro-5-(cyclohexen-1-yl)-3-fluorohexan-2-ol (PubChem CID 153333915) has the molecular formula C12H20ClFO and a molecular weight of 234.74 g/mol. Its IUPAC name is 4-chloro-5-(cyclohexen-1-yl)-3-fluorohexan-2-ol.
| Compound Name | 4-chloro-5-(cyclohexen-1-yl)-3-fluorohexan-2-ol |
|---|---|
| PubChem CID | 153333915 |
| Molecular Formula | C12H20ClFO |
| Molecular Weight | 234.74 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 4-chloro-5-(cyclohexen-1-yl)-3-fluorohexan-2-ol |
| SMILES | CC(O)C(F)C(Cl)C(C)C1=CCCCC1 |
| InChI | InChI=1S/C12H20ClFO/c1-8(10-6-4-3-5-7-10)11(13)12(14)9(2)15/h6,8-9,11-12,15H,3-5,7H2,1-2H3 |
| InChIKey | QUDQNRZCUBJLHJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.74 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|