C14H25ClO — CID 138977954
(4R,6S)-2-(chloromethyl)-6,10-dimethylundeca-1,9-dien-4-ol (PubChem CID 138977954) has the molecular formula C14H25ClO and a molecular weight of 244.81 g/mol. Its IUPAC name is (4R,6S)-2-(chloromethyl)-6,10-dimethylundeca-1,9-dien-4-ol.
| Compound Name | (4R,6S)-2-(chloromethyl)-6,10-dimethylundeca-1,9-dien-4-ol |
|---|---|
| PubChem CID | 138977954 |
| Molecular Formula | C14H25ClO |
| Molecular Weight | 244.81 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (4R,6S)-2-(chloromethyl)-6,10-dimethylundeca-1,9-dien-4-ol |
| SMILES | C=C(CCl)C[C@H](O)C[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C14H25ClO/c1-11(2)6-5-7-12(3)8-14(16)9-13(4)10-15/h6,12,14,16H,4-5,7-10H2,1-3H3/t12-,14+/m0/s1 |
| InChIKey | ZZVGBABXEUVAAN-GXTWGEPZSA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.81 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|