C12H17ClO — CID 56983155
cis-(1R,2S)-2-[(6-chlorocyclohexa-1,4-dien-1-yl)methyl]cyclopentan-1-ol (PubChem CID 56983155) has the molecular formula C12H17ClO and a molecular weight of 212.72 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(6-chlorocyclohexa-1,4-dien-1-yl)methyl]cyclopentan-1-ol.
| Compound Name | cis-(1R,2S)-2-[(6-chlorocyclohexa-1,4-dien-1-yl)methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 56983155 |
| Molecular Formula | C12H17ClO |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | cis-(1R,2S)-2-[(6-chlorocyclohexa-1,4-dien-1-yl)methyl]cyclopentan-1-ol |
| SMILES | O[C@@H]1CCC[C@H]1CC1=CCC=CC1Cl |
| InChI | InChI=1S/C12H17ClO/c13-11-6-2-1-4-9(11)8-10-5-3-7-12(10)14/h2,4,6,10-12,14H,1,3,5,7-8H2/t10-,11?,12+/m0/s1 |
| InChIKey | DENZEXUSHGTRKM-ASKATJPDSA-N |
| XLogP | 3.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|