C10H4Cl3NO — CID 13090840
3,7-dichloroquinoline-8-carbonyl chloride (PubChem CID 13090840) has the molecular formula C10H4Cl3NO and a molecular weight of 260.51 g/mol. Its IUPAC name is 3,7-dichloroquinoline-8-carbonyl chloride.
| Compound Name | 3,7-dichloroquinoline-8-carbonyl chloride |
|---|---|
| PubChem CID | 13090840 |
| Molecular Formula | C10H4Cl3NO |
| Molecular Weight | 260.51 g/mol |
| Exact Mass | 258.94 |
| IUPAC Name | 3,7-dichloroquinoline-8-carbonyl chloride |
| SMILES | O=C(Cl)c1c(Cl)ccc2cc(Cl)cnc12 |
| InChI | InChI=1S/C10H4Cl3NO/c11-6-3-5-1-2-7(12)8(10(13)15)9(5)14-4-6/h1-4H |
| InChIKey | UTLUHRLLWAIKEY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|