C8H12N4O — CID 130909096
N-[1-(1-methyl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide (PubChem CID 130909096) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is N-[1-(1-methyl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide.
| Compound Name | N-[1-(1-methyl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 130909096 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | N-[1-(1-methyl-1,2,4-triazol-3-yl)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(C)c1ncn(C)n1 |
| InChI | InChI=1S/C8H12N4O/c1-4-7(13)10-6(2)8-9-5-12(3)11-8/h4-6H,1H2,2-3H3,(H,10,13) |
| InChIKey | UBCKAMXZRZJIBZ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|