C8H14O3 — CID 130918403
(2R,3R,5R)-5-ethenyl-2-[(1S)-1-hydroxyethyl]oxolan-3-ol (PubChem CID 130918403) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (2R,3R,5R)-5-ethenyl-2-[(1S)-1-hydroxyethyl]oxolan-3-ol.
| Compound Name | (2R,3R,5R)-5-ethenyl-2-[(1S)-1-hydroxyethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 130918403 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (2R,3R,5R)-5-ethenyl-2-[(1S)-1-hydroxyethyl]oxolan-3-ol |
| SMILES | C=C[C@H]1C[C@@H](O)[C@@H]([C@H](C)O)O1 |
| InChI | InChI=1S/C8H14O3/c1-3-6-4-7(10)8(11-6)5(2)9/h3,5-10H,1,4H2,2H3/t5-,6-,7+,8+/m0/s1 |
| InChIKey | KKGAALMNOKIXIC-RULNZFCNSA-N |
| XLogP | 0.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|