C10H13NO2S — CID 130927979
7-oxabicyclo[2.2.1]heptan-2-yl(1,2-thiazol-3-yl)methanol (PubChem CID 130927979) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 7-oxabicyclo[2.2.1]heptan-2-yl(1,2-thiazol-3-yl)methanol.
| Compound Name | 7-oxabicyclo[2.2.1]heptan-2-yl(1,2-thiazol-3-yl)methanol |
|---|---|
| PubChem CID | 130927979 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 7-oxabicyclo[2.2.1]heptan-2-yl(1,2-thiazol-3-yl)methanol |
| SMILES | OC(c1ccsn1)C1CC2CCC1O2 |
| InChI | InChI=1S/C10H13NO2S/c12-10(8-3-4-14-11-8)7-5-6-1-2-9(7)13-6/h3-4,6-7,9-10,12H,1-2,5H2 |
| InChIKey | BGQLKOCDXGEFTK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |