C9H13NO2S — CID 130715054
(2-methyloxolan-3-yl)-(1,2-thiazol-3-yl)methanol (PubChem CID 130715054) has the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. Its IUPAC name is (2-methyloxolan-3-yl)-(1,2-thiazol-3-yl)methanol.
| Compound Name | (2-methyloxolan-3-yl)-(1,2-thiazol-3-yl)methanol |
|---|---|
| PubChem CID | 130715054 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | (2-methyloxolan-3-yl)-(1,2-thiazol-3-yl)methanol |
| SMILES | CC1OCCC1C(O)c1ccsn1 |
| InChI | InChI=1S/C9H13NO2S/c1-6-7(2-4-12-6)9(11)8-3-5-13-10-8/h3,5-7,9,11H,2,4H2,1H3 |
| InChIKey | PSONBDUAYQLVMX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |