C10H15NO2S — CID 131140404
(2-ethyloxolan-3-yl)-(1,2-thiazol-3-yl)methanol (PubChem CID 131140404) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is (2-ethyloxolan-3-yl)-(1,2-thiazol-3-yl)methanol.
| Compound Name | (2-ethyloxolan-3-yl)-(1,2-thiazol-3-yl)methanol |
|---|---|
| PubChem CID | 131140404 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (2-ethyloxolan-3-yl)-(1,2-thiazol-3-yl)methanol |
| SMILES | CCC1OCCC1C(O)c1ccsn1 |
| InChI | InChI=1S/C10H15NO2S/c1-2-9-7(3-5-13-9)10(12)8-4-6-14-11-8/h4,6-7,9-10,12H,2-3,5H2,1H3 |
| InChIKey | PFXVUFKWKVHHLC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |