C11H16N2 — CID 130933659
4-N-methyl-4-N-(2-methylprop-2-enyl)benzene-1,4-diamine (PubChem CID 130933659) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 4-N-methyl-4-N-(2-methylprop-2-enyl)benzene-1,4-diamine.
| Compound Name | 4-N-methyl-4-N-(2-methylprop-2-enyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 130933659 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 4-N-methyl-4-N-(2-methylprop-2-enyl)benzene-1,4-diamine |
| SMILES | C=C(C)CN(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C11H16N2/c1-9(2)8-13(3)11-6-4-10(12)5-7-11/h4-7H,1,8,12H2,2-3H3 |
| InChIKey | FBCWZWHNWYTOKI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|