C7H13ClOS — CID 130934712
(2S,3R)-2-chloro-3-ethylsulfanyloxane (PubChem CID 130934712) has the molecular formula C7H13ClOS and a molecular weight of 180.70 g/mol. Its IUPAC name is (2S,3R)-2-chloro-3-ethylsulfanyloxane.
| Compound Name | (2S,3R)-2-chloro-3-ethylsulfanyloxane |
|---|---|
| PubChem CID | 130934712 |
| Molecular Formula | C7H13ClOS |
| Molecular Weight | 180.70 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | (2S,3R)-2-chloro-3-ethylsulfanyloxane |
| SMILES | CCS[C@@H]1CCCO[C@H]1Cl |
| InChI | InChI=1S/C7H13ClOS/c1-2-10-6-4-3-5-9-7(6)8/h6-7H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | WDZITDRXEGSCNG-RNFRBKRXSA-N |
| XLogP | 2.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.70 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|