C8H14N2O3S — CID 130942808
5,5-dimethyl-1-(2-methylsulfinylethyl)imidazolidine-2,4-dione (PubChem CID 130942808) has the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. Its IUPAC name is 5,5-dimethyl-1-(2-methylsulfinylethyl)imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-1-(2-methylsulfinylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 130942808 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 5,5-dimethyl-1-(2-methylsulfinylethyl)imidazolidine-2,4-dione |
| SMILES | CS(=O)CCN1C(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C8H14N2O3S/c1-8(2)6(11)9-7(12)10(8)4-5-14(3)13/h4-5H2,1-3H3,(H,9,11,12) |
| InChIKey | VBGJURLQLJQUIE-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|