C11H20N2O4 — CID 158725431
5,5-dimethyl-1-(oxiran-2-ylmethyl)imidazolidine-2,4-dione;propan-2-ol (PubChem CID 158725431) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is 5,5-dimethyl-1-(oxiran-2-ylmethyl)imidazolidine-2,4-dione;propan-2-ol.
| Compound Name | 5,5-dimethyl-1-(oxiran-2-ylmethyl)imidazolidine-2,4-dione;propan-2-ol |
|---|---|
| PubChem CID | 158725431 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 5,5-dimethyl-1-(oxiran-2-ylmethyl)imidazolidine-2,4-dione;propan-2-ol |
| SMILES | CC(C)O.CC1(C)C(=O)NC(=O)N1CC1CO1 |
| InChI | InChI=1S/C8H12N2O3.C3H8O/c1-8(2)6(11)9-7(12)10(8)3-5-4-13-5;1-3(2)4/h5H,3-4H2,1-2H3,(H,9,11,12);3-4H,1-2H3 |
| InChIKey | IKLCAHDGSGDQAG-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|