C15H25N3O3 — CID 88733499
7,7,8,9,9-pentamethyl-1-(oxiran-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 88733499) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 7,7,8,9,9-pentamethyl-1-(oxiran-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 7,7,8,9,9-pentamethyl-1-(oxiran-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 88733499 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 7,7,8,9,9-pentamethyl-1-(oxiran-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(C)(C)CC2(CC1(C)C)C(=O)NC(=O)N2CC1CO1 |
| InChI | InChI=1S/C15H25N3O3/c1-13(2)8-15(9-14(3,4)17(13)5)11(19)16-12(20)18(15)6-10-7-21-10/h10H,6-9H2,1-5H3,(H,16,19,20) |
| InChIKey | ZSZAPIYADGUIMM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|