C12H20N2O3 — CID 154133288
5,5-dimethyl-3-(oxiran-2-ylmethyl)-6-propan-2-yl-1,3-diazinane-2,4-dione (PubChem CID 154133288) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 5,5-dimethyl-3-(oxiran-2-ylmethyl)-6-propan-2-yl-1,3-diazinane-2,4-dione.
| Compound Name | 5,5-dimethyl-3-(oxiran-2-ylmethyl)-6-propan-2-yl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 154133288 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 5,5-dimethyl-3-(oxiran-2-ylmethyl)-6-propan-2-yl-1,3-diazinane-2,4-dione |
| SMILES | CC(C)C1NC(=O)N(CC2CO2)C(=O)C1(C)C |
| InChI | InChI=1S/C12H20N2O3/c1-7(2)9-12(3,4)10(15)14(11(16)13-9)5-8-6-17-8/h7-9H,5-6H2,1-4H3,(H,13,16) |
| InChIKey | OICUINPGXKOQGX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 61.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|