C11H18BrN3 — CID 130943541
3-(2-bromocycloheptyl)-4,5-dimethyl-1,2,4-triazole (PubChem CID 130943541) has the molecular formula C11H18BrN3 and a molecular weight of 272.19 g/mol. Its IUPAC name is 3-(2-bromocycloheptyl)-4,5-dimethyl-1,2,4-triazole.
| Compound Name | 3-(2-bromocycloheptyl)-4,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 130943541 |
| Molecular Formula | C11H18BrN3 |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 3-(2-bromocycloheptyl)-4,5-dimethyl-1,2,4-triazole |
| SMILES | Cc1nnc(C2CCCCCC2Br)n1C |
| InChI | InChI=1S/C11H18BrN3/c1-8-13-14-11(15(8)2)9-6-4-3-5-7-10(9)12/h9-10H,3-7H2,1-2H3 |
| InChIKey | SQTITDNCBCTEHR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|