methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate

C9H7NO3S — CID 130950941

IUPACmethyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate
SMILESCOC(=O)c1nc2cccc(S)c2o1
InChIInChI=1S/C9H7NO3S/c1-12-9(11)8-10-5-3-2-4-6(14)7(5)13-8/h2-4,14H,1H3
InChIKeyIOLASKIGKJMUDQ-UHFFFAOYSA-N
MW209.23 g/mol
LogP1.90
Rot. Bonds1

About methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate

methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate (PubChem CID 130950941) has the molecular formula C9H7NO3S and a molecular weight of 209.23 g/mol. Its IUPAC name is methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate.

Molecular Properties

Compound Namemethyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate
PubChem CID130950941
Molecular FormulaC9H7NO3S
Molecular Weight209.23 g/mol
Exact Mass209.01
IUPAC Namemethyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate
SMILESCOC(=O)c1nc2cccc(S)c2o1
InChIInChI=1S/C9H7NO3S/c1-12-9(11)8-10-5-3-2-4-6(14)7(5)13-8/h2-4,14H,1H3
InChIKeyIOLASKIGKJMUDQ-UHFFFAOYSA-N
XLogP1.90
TPSA52.33 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.23
LogP ≤ 51.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate?
The IUPAC name of methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate (CID 130950941) is methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate.
What is the SMILES notation for methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate?
The canonical SMILES for methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate is COC(=O)c1nc2cccc(S)c2o1.
What is the InChIKey of methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate?
The InChIKey is IOLASKIGKJMUDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3S/c1-12-9(11)8-10-5-3-2-4-6(14)7(5)13-8/h2-4,14H,1H3.
What are the key properties of methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate?
methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate has a molecular weight of 209.23 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate is sourced from PubChem (CID 130950941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).