C9H7NO3S — CID 130950941
methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate (PubChem CID 130950941) has the molecular formula C9H7NO3S and a molecular weight of 209.23 g/mol. Its IUPAC name is methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate.
| Compound Name | methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate |
|---|---|
| PubChem CID | 130950941 |
| Molecular Formula | C9H7NO3S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | methyl 7-sulfanyl-1,3-benzoxazole-2-carboxylate |
| SMILES | COC(=O)c1nc2cccc(S)c2o1 |
| InChI | InChI=1S/C9H7NO3S/c1-12-9(11)8-10-5-3-2-4-6(14)7(5)13-8/h2-4,14H,1H3 |
| InChIKey | IOLASKIGKJMUDQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|