C11H23ClN2 — CID 130962018
(3aS,6aS)-1-(3-methylbutyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole;hydrochloride (PubChem CID 130962018) has the molecular formula C11H23ClN2 and a molecular weight of 218.77 g/mol. Its IUPAC name is (3aS,6aS)-1-(3-methylbutyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole;hydrochloride.
| Compound Name | (3aS,6aS)-1-(3-methylbutyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 130962018 |
| Molecular Formula | C11H23ClN2 |
| Molecular Weight | 218.77 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (3aS,6aS)-1-(3-methylbutyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole;hydrochloride |
| SMILES | CC(C)CCN1CC[C@H]2CNC[C@H]21.Cl |
| InChI | InChI=1S/C11H22N2.ClH/c1-9(2)3-5-13-6-4-10-7-12-8-11(10)13;/h9-12H,3-8H2,1-2H3;1H/t10-,11+;/m0./s1 |
| InChIKey | GGOCDVMOIBRASV-VZXYPILPSA-N |
| XLogP | 1.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.77 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |