C12H24N2 — CID 131141034
(3aR,6aR)-1-(2,2-dimethylbutyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole (PubChem CID 131141034) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is (3aR,6aR)-1-(2,2-dimethylbutyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole.
| Compound Name | (3aR,6aR)-1-(2,2-dimethylbutyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole |
|---|---|
| PubChem CID | 131141034 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (3aR,6aR)-1-(2,2-dimethylbutyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole |
| SMILES | CCC(C)(C)CN1CC[C@@H]2CNC[C@@H]21 |
| InChI | InChI=1S/C12H24N2/c1-4-12(2,3)9-14-6-5-10-7-13-8-11(10)14/h10-11,13H,4-9H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | BKCOYGMAPLKIIU-MNOVXSKESA-N |
| XLogP | 1.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |