C11H16BrNS2 — CID 130964381
4-[(5-bromothiophen-2-yl)methyl]-5-methyl-1,4-thiazepane (PubChem CID 130964381) has the molecular formula C11H16BrNS2 and a molecular weight of 306.29 g/mol. Its IUPAC name is 4-[(5-bromothiophen-2-yl)methyl]-5-methyl-1,4-thiazepane.
| Compound Name | 4-[(5-bromothiophen-2-yl)methyl]-5-methyl-1,4-thiazepane |
|---|---|
| PubChem CID | 130964381 |
| Molecular Formula | C11H16BrNS2 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 4-[(5-bromothiophen-2-yl)methyl]-5-methyl-1,4-thiazepane |
| SMILES | CC1CCSCCN1Cc1ccc(Br)s1 |
| InChI | InChI=1S/C11H16BrNS2/c1-9-4-6-14-7-5-13(9)8-10-2-3-11(12)15-10/h2-3,9H,4-8H2,1H3 |
| InChIKey | BLCXHSBOBOFFSY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |