C10H16O3 — CID 130971202
(1R,2S)-1-hydroxy-2-propan-2-ylcyclohex-3-ene-1-carboxylic acid (PubChem CID 130971202) has the molecular formula C10H16O3 and a molecular weight of 184.24 g/mol. Its IUPAC name is (1R,2S)-1-hydroxy-2-propan-2-ylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,2S)-1-hydroxy-2-propan-2-ylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 130971202 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (1R,2S)-1-hydroxy-2-propan-2-ylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC(C)[C@H]1C=CCC[C@]1(O)C(=O)O |
| InChI | InChI=1S/C10H16O3/c1-7(2)8-5-3-4-6-10(8,13)9(11)12/h3,5,7-8,13H,4,6H2,1-2H3,(H,11,12)/t8-,10-/m1/s1 |
| InChIKey | KGUAKKDWFFNWKX-PSASIEDQSA-N |
| XLogP | 1.42 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|