C18H28O5 — CID 169024364
2-[2-[(4E)-1-methyl-6-propan-2-ylcyclooct-4-en-1-yl]-2-oxoethyl]butanedioic acid (PubChem CID 169024364) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-[2-[(4E)-1-methyl-6-propan-2-ylcyclooct-4-en-1-yl]-2-oxoethyl]butanedioic acid.
| Compound Name | 2-[2-[(4E)-1-methyl-6-propan-2-ylcyclooct-4-en-1-yl]-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 169024364 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 2-[2-[(4E)-1-methyl-6-propan-2-ylcyclooct-4-en-1-yl]-2-oxoethyl]butanedioic acid |
| SMILES | CC(C)C1/C=C\CCC(C)(C(=O)CC(CC(=O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C18H28O5/c1-12(2)13-6-4-5-8-18(3,9-7-13)15(19)10-14(17(22)23)11-16(20)21/h4,6,12-14H,5,7-11H2,1-3H3,(H,20,21)(H,22,23)/b6-4- |
| InChIKey | PVBBRXZHHNVAJW-XQRVVYSFSA-N |
| XLogP | 3.53 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|