C8H6O2S2 — CID 130971818
7-sulfanyl-1-benzothiophene-2,4-diol (PubChem CID 130971818) has the molecular formula C8H6O2S2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 7-sulfanyl-1-benzothiophene-2,4-diol.
| Compound Name | 7-sulfanyl-1-benzothiophene-2,4-diol |
|---|---|
| PubChem CID | 130971818 |
| Molecular Formula | C8H6O2S2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | 7-sulfanyl-1-benzothiophene-2,4-diol |
| SMILES | Oc1cc2c(O)ccc(S)c2s1 |
| InChI | InChI=1S/C8H6O2S2/c9-5-1-2-6(11)8-4(5)3-7(10)12-8/h1-3,9-11H |
| InChIKey | SVUXXHZOLSUKOI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|