C10H10O3S — CID 131191647
4-ethoxy-1-benzothiophene-2,7-diol (PubChem CID 131191647) has the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. Its IUPAC name is 4-ethoxy-1-benzothiophene-2,7-diol.
| Compound Name | 4-ethoxy-1-benzothiophene-2,7-diol |
|---|---|
| PubChem CID | 131191647 |
| Molecular Formula | C10H10O3S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 4-ethoxy-1-benzothiophene-2,7-diol |
| SMILES | CCOc1ccc(O)c2sc(O)cc12 |
| InChI | InChI=1S/C10H10O3S/c1-2-13-8-4-3-7(11)10-6(8)5-9(12)14-10/h3-5,11-12H,2H2,1H3 |
| InChIKey | UHPYVASAQBUSBY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |