C11H10F2S — CID 130971820
5-(difluoromethyl)-6,7-dimethyl-1-benzothiophene (PubChem CID 130971820) has the molecular formula C11H10F2S and a molecular weight of 212.26 g/mol. Its IUPAC name is 5-(difluoromethyl)-6,7-dimethyl-1-benzothiophene.
| Compound Name | 5-(difluoromethyl)-6,7-dimethyl-1-benzothiophene |
|---|---|
| PubChem CID | 130971820 |
| Molecular Formula | C11H10F2S |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 5-(difluoromethyl)-6,7-dimethyl-1-benzothiophene |
| SMILES | Cc1c(C(F)F)cc2ccsc2c1C |
| InChI | InChI=1S/C11H10F2S/c1-6-7(2)10-8(3-4-14-10)5-9(6)11(12)13/h3-5,11H,1-2H3 |
| InChIKey | OBKDBTHYCVLBSK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |