C9H4Cl2F2S — CID 130785826
4,7-dichloro-6-(difluoromethyl)-1-benzothiophene (PubChem CID 130785826) has the molecular formula C9H4Cl2F2S and a molecular weight of 253.10 g/mol. Its IUPAC name is 4,7-dichloro-6-(difluoromethyl)-1-benzothiophene.
| Compound Name | 4,7-dichloro-6-(difluoromethyl)-1-benzothiophene |
|---|---|
| PubChem CID | 130785826 |
| Molecular Formula | C9H4Cl2F2S |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 251.94 |
| IUPAC Name | 4,7-dichloro-6-(difluoromethyl)-1-benzothiophene |
| SMILES | FC(F)c1cc(Cl)c2ccsc2c1Cl |
| InChI | InChI=1S/C9H4Cl2F2S/c10-6-3-5(9(12)13)7(11)8-4(6)1-2-14-8/h1-3,9H |
| InChIKey | ZAFXRCLEJYUAQU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |