C8H5Cl2NS — CID 131198058
4,6-dichloro-1-benzothiophen-7-amine (PubChem CID 131198058) has the molecular formula C8H5Cl2NS and a molecular weight of 218.11 g/mol. Its IUPAC name is 4,6-dichloro-1-benzothiophen-7-amine.
| Compound Name | 4,6-dichloro-1-benzothiophen-7-amine |
|---|---|
| PubChem CID | 131198058 |
| Molecular Formula | C8H5Cl2NS |
| Molecular Weight | 218.11 g/mol |
| Exact Mass | 216.95 |
| IUPAC Name | 4,6-dichloro-1-benzothiophen-7-amine |
| SMILES | Nc1c(Cl)cc(Cl)c2ccsc12 |
| InChI | InChI=1S/C8H5Cl2NS/c9-5-3-6(10)7(11)8-4(5)1-2-12-8/h1-3H,11H2 |
| InChIKey | NSAMFFUMRCNXGH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.11 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|