C8H7ClN2S — CID 131191037
4-chloro-1-benzothiophene-6,7-diamine (PubChem CID 131191037) has the molecular formula C8H7ClN2S and a molecular weight of 198.68 g/mol. Its IUPAC name is 4-chloro-1-benzothiophene-6,7-diamine.
| Compound Name | 4-chloro-1-benzothiophene-6,7-diamine |
|---|---|
| PubChem CID | 131191037 |
| Molecular Formula | C8H7ClN2S |
| Molecular Weight | 198.68 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 4-chloro-1-benzothiophene-6,7-diamine |
| SMILES | Nc1cc(Cl)c2ccsc2c1N |
| InChI | InChI=1S/C8H7ClN2S/c9-5-3-6(10)7(11)8-4(5)1-2-12-8/h1-3H,10-11H2 |
| InChIKey | QJSOBLAXHIONHE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.68 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|