C12H10Br3NO2 — CID 13097775
3,3-dibromo-2-(3-bromo-4-methoxyphenyl)oxolane-2-carbonitrile (PubChem CID 13097775) has the molecular formula C12H10Br3NO2 and a molecular weight of 439.93 g/mol. Its IUPAC name is 3,3-dibromo-2-(3-bromo-4-methoxyphenyl)oxolane-2-carbonitrile.
| Compound Name | 3,3-dibromo-2-(3-bromo-4-methoxyphenyl)oxolane-2-carbonitrile |
|---|---|
| PubChem CID | 13097775 |
| Molecular Formula | C12H10Br3NO2 |
| Molecular Weight | 439.93 g/mol |
| Exact Mass | 436.83 |
| IUPAC Name | 3,3-dibromo-2-(3-bromo-4-methoxyphenyl)oxolane-2-carbonitrile |
| SMILES | COc1ccc(C2(C#N)OCCC2(Br)Br)cc1Br |
| InChI | InChI=1S/C12H10Br3NO2/c1-17-10-3-2-8(6-9(10)13)11(7-16)12(14,15)4-5-18-11/h2-3,6H,4-5H2,1H3 |
| InChIKey | UYLWHFMMFYBIRA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.93 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|