C9H16O — CID 130977977
(1R,2R,4S,6S)-6-methylbicyclo[2.2.2]octan-2-ol (PubChem CID 130977977) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (1R,2R,4S,6S)-6-methylbicyclo[2.2.2]octan-2-ol.
| Compound Name | (1R,2R,4S,6S)-6-methylbicyclo[2.2.2]octan-2-ol |
|---|---|
| PubChem CID | 130977977 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (1R,2R,4S,6S)-6-methylbicyclo[2.2.2]octan-2-ol |
| SMILES | C[C@H]1C[C@@H]2CC[C@H]1[C@H](O)C2 |
| InChI | InChI=1S/C9H16O/c1-6-4-7-2-3-8(6)9(10)5-7/h6-10H,2-5H2,1H3/t6-,7-,8+,9+/m0/s1 |
| InChIKey | OOFGEKAPKBDXES-RBXMUDONSA-N |
| XLogP | 1.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |