C9H14O3 — CID 55251773
(1R,4S)-6-hydroxybicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 55251773) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is (1R,4S)-6-hydroxybicyclo[2.2.2]octane-2-carboxylic acid.
| Compound Name | (1R,4S)-6-hydroxybicyclo[2.2.2]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 55251773 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (1R,4S)-6-hydroxybicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | O=C(O)C1C[C@@H]2CC[C@H]1C(O)C2 |
| InChI | InChI=1S/C9H14O3/c10-8-4-5-1-2-6(8)7(3-5)9(11)12/h5-8,10H,1-4H2,(H,11,12)/t5-,6+,7?,8?/m0/s1 |
| InChIKey | BJTBIPDUJVASJY-JAFIHTMFSA-N |
| XLogP | 0.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |