C12H18O2 — CID 130978565
(1R,6S,7S,9R)-6-(hydroxymethyl)-10-methylidenetricyclo[5.2.1.01,6]decan-9-ol (PubChem CID 130978565) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (1R,6S,7S,9R)-6-(hydroxymethyl)-10-methylidenetricyclo[5.2.1.01,6]decan-9-ol.
| Compound Name | (1R,6S,7S,9R)-6-(hydroxymethyl)-10-methylidenetricyclo[5.2.1.01,6]decan-9-ol |
|---|---|
| PubChem CID | 130978565 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (1R,6S,7S,9R)-6-(hydroxymethyl)-10-methylidenetricyclo[5.2.1.01,6]decan-9-ol |
| SMILES | C=C1[C@@H]2C[C@@H](O)[C@]13CCCC[C@]23CO |
| InChI | InChI=1S/C12H18O2/c1-8-9-6-10(14)12(8)5-3-2-4-11(9,12)7-13/h9-10,13-14H,1-7H2/t9-,10+,11-,12-/m0/s1 |
| InChIKey | RIIFSCGUHCGHSU-USZNOCQGSA-N |
| XLogP | 1.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|