C20H34O6 — CID 163107144
5a-(hydroxymethyl)-10a-methyl-9-methylidene-3-propan-2-yl-1,2,4,5,6,7,8,10-octahydrobenzo[f]azulene-3,3a,6,8,9a-pentol (PubChem CID 163107144) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is 5a-(hydroxymethyl)-10a-methyl-9-methylidene-3-propan-2-yl-1,2,4,5,6,7,8,10-octahydrobenzo[f]azulene-3,3a,6,8,9a-pentol.
| Compound Name | 5a-(hydroxymethyl)-10a-methyl-9-methylidene-3-propan-2-yl-1,2,4,5,6,7,8,10-octahydrobenzo[f]azulene-3,3a,6,8,9a-pentol |
|---|---|
| PubChem CID | 163107144 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 5a-(hydroxymethyl)-10a-methyl-9-methylidene-3-propan-2-yl-1,2,4,5,6,7,8,10-octahydrobenzo[f]azulene-3,3a,6,8,9a-pentol |
| SMILES | C=C1C(O)CC(O)C2(CO)CCC3(O)C(C)(CCC3(O)C(C)C)CC12O |
| InChI | InChI=1S/C20H34O6/c1-12(2)18(24)7-5-16(4)10-19(25)13(3)14(22)9-15(23)17(19,11-21)6-8-20(16,18)26/h12,14-15,21-26H,3,5-11H2,1-2,4H3 |
| InChIKey | AJYFXQZYMUVGKD-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|