C10H16O3 — CID 59977329
(7S)-2-(hydroxymethyl)-7-methyl-4-methylidene-1-oxaspiro[2.5]octan-5-ol (PubChem CID 59977329) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (7S)-2-(hydroxymethyl)-7-methyl-4-methylidene-1-oxaspiro[2.5]octan-5-ol.
| Compound Name | (7S)-2-(hydroxymethyl)-7-methyl-4-methylidene-1-oxaspiro[2.5]octan-5-ol |
|---|---|
| PubChem CID | 59977329 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (7S)-2-(hydroxymethyl)-7-methyl-4-methylidene-1-oxaspiro[2.5]octan-5-ol |
| SMILES | C=C1C(O)C[C@H](C)CC12OC2CO |
| InChI | InChI=1S/C10H16O3/c1-6-3-8(12)7(2)10(4-6)9(5-11)13-10/h6,8-9,11-12H,2-5H2,1H3/t6-,8?,9?,10?/m0/s1 |
| InChIKey | NEDZIUDKRUPRSR-OAEOSPOYSA-N |
| XLogP | 0.46 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|