C10H16I2O — CID 11090784
(1S,2R,4R,7R)-1,7-bis(iodomethyl)-7-methylbicyclo[2.2.1]heptan-2-ol (PubChem CID 11090784) has the molecular formula C10H16I2O and a molecular weight of 406.05 g/mol. Its IUPAC name is (1S,2R,4R,7R)-1,7-bis(iodomethyl)-7-methylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1S,2R,4R,7R)-1,7-bis(iodomethyl)-7-methylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 11090784 |
| Molecular Formula | C10H16I2O |
| Molecular Weight | 406.05 g/mol |
| Exact Mass | 405.93 |
| IUPAC Name | (1S,2R,4R,7R)-1,7-bis(iodomethyl)-7-methylbicyclo[2.2.1]heptan-2-ol |
| SMILES | C[C@@]1(CI)[C@@H]2CC[C@@]1(CI)[C@H](O)C2 |
| InChI | InChI=1S/C10H16I2O/c1-9(5-11)7-2-3-10(9,6-12)8(13)4-7/h7-8,13H,2-6H2,1H3/t7-,8-,9-,10-/m1/s1 |
| InChIKey | LMCIADVTJLWOCM-ZYUZMQFOSA-N |
| XLogP | 3.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.05 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|