C6H7Br2N3 — CID 13098165
3,5-dibromo-N,N-dimethylpyrazin-2-amine (PubChem CID 13098165) has the molecular formula C6H7Br2N3 and a molecular weight of 280.95 g/mol. Its IUPAC name is 3,5-dibromo-N,N-dimethylpyrazin-2-amine.
| Compound Name | 3,5-dibromo-N,N-dimethylpyrazin-2-amine |
|---|---|
| PubChem CID | 13098165 |
| Molecular Formula | C6H7Br2N3 |
| Molecular Weight | 280.95 g/mol |
| Exact Mass | 278.90 |
| IUPAC Name | 3,5-dibromo-N,N-dimethylpyrazin-2-amine |
| SMILES | CN(C)c1ncc(Br)nc1Br |
| InChI | InChI=1S/C6H7Br2N3/c1-11(2)6-5(8)10-4(7)3-9-6/h3H,1-2H3 |
| InChIKey | VZBCSKITGQNOCM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.95 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |