C10H10O2 — CID 130985797
(1S,7R)-11-oxatricyclo[5.3.1.01,5]undeca-4,8-dien-10-one (PubChem CID 130985797) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is (1S,7R)-11-oxatricyclo[5.3.1.01,5]undeca-4,8-dien-10-one.
| Compound Name | (1S,7R)-11-oxatricyclo[5.3.1.01,5]undeca-4,8-dien-10-one |
|---|---|
| PubChem CID | 130985797 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (1S,7R)-11-oxatricyclo[5.3.1.01,5]undeca-4,8-dien-10-one |
| SMILES | O=C1C=C[C@H]2CC3=CCC[C@@]13O2 |
| InChI | InChI=1S/C10H10O2/c11-9-4-3-8-6-7-2-1-5-10(7,9)12-8/h2-4,8H,1,5-6H2/t8-,10-/m0/s1 |
| InChIKey | LAXRPWMWEBNBMF-WPRPVWTQSA-N |
| XLogP | 1.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|