C11H12O2 — CID 14315361
4-methylidene-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one (PubChem CID 14315361) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is 4-methylidene-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one.
| Compound Name | 4-methylidene-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one |
|---|---|
| PubChem CID | 14315361 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 4-methylidene-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one |
| SMILES | C=C1CCC23OC(C=CC2=O)CC13 |
| InChI | InChI=1S/C11H12O2/c1-7-4-5-11-9(7)6-8(13-11)2-3-10(11)12/h2-3,8-9H,1,4-6H2 |
| InChIKey | HYZSDPGCYKLUHQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|