C10H12O2 — CID 56594803
(1S,5S,7R)-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one (PubChem CID 56594803) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (1S,5S,7R)-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one.
| Compound Name | (1S,5S,7R)-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one |
|---|---|
| PubChem CID | 56594803 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (1S,5S,7R)-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one |
| SMILES | O=C1C=C[C@H]2C[C@@H]3CCC[C@@]13O2 |
| InChI | InChI=1S/C10H12O2/c11-9-4-3-8-6-7-2-1-5-10(7,9)12-8/h3-4,7-8H,1-2,5-6H2/t7-,8-,10-/m0/s1 |
| InChIKey | GXOJLYIBJNPXDJ-NRPADANISA-N |
| XLogP | 1.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |