About (1-methylcyclobutyl) propanoate
(1-methylcyclobutyl) propanoate (PubChem CID 130991217) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is (1-methylcyclobutyl) propanoate.
Molecular Properties
| Compound Name | (1-methylcyclobutyl) propanoate |
| PubChem CID | 130991217 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (1-methylcyclobutyl) propanoate |
| SMILES | CCC(=O)OC1(C)CCC1 |
| InChI | InChI=1S/C8H14O2/c1-3-7(9)10-8(2)5-4-6-8/h3-6H2,1-2H3 |
| InChIKey | JINATZIYSKYRDV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-methylcyclobutyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclobutyl) propanoate?
The IUPAC name of (1-methylcyclobutyl) propanoate (CID 130991217) is (1-methylcyclobutyl) propanoate.
What is the SMILES notation for (1-methylcyclobutyl) propanoate?
The canonical SMILES for (1-methylcyclobutyl) propanoate is CCC(=O)OC1(C)CCC1.
What is the InChIKey of (1-methylcyclobutyl) propanoate?
The InChIKey is JINATZIYSKYRDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-3-7(9)10-8(2)5-4-6-8/h3-6H2,1-2H3.
What are the key properties of (1-methylcyclobutyl) propanoate?
(1-methylcyclobutyl) propanoate has a molecular weight of 142.20 g/mol, XLogP of 1.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclobutyl) propanoate is sourced from PubChem (CID 130991217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).