C8H14O2 — CID 130993525
(2S,3R,4R)-2-methoxy-3,4-dimethylcyclopentan-1-one (PubChem CID 130993525) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (2S,3R,4R)-2-methoxy-3,4-dimethylcyclopentan-1-one.
| Compound Name | (2S,3R,4R)-2-methoxy-3,4-dimethylcyclopentan-1-one |
|---|---|
| PubChem CID | 130993525 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (2S,3R,4R)-2-methoxy-3,4-dimethylcyclopentan-1-one |
| SMILES | CO[C@@H]1C(=O)C[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C8H14O2/c1-5-4-7(9)8(10-3)6(5)2/h5-6,8H,4H2,1-3H3/t5-,6-,8+/m1/s1 |
| InChIKey | UHFIBDIXQNDVPA-JKMUOGBPSA-N |
| XLogP | 1.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |