C11H20N2O — CID 131000694
3-methyl-2-(1,4-oxazepan-4-ylmethyl)butanenitrile (PubChem CID 131000694) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-methyl-2-(1,4-oxazepan-4-ylmethyl)butanenitrile.
| Compound Name | 3-methyl-2-(1,4-oxazepan-4-ylmethyl)butanenitrile |
|---|---|
| PubChem CID | 131000694 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 3-methyl-2-(1,4-oxazepan-4-ylmethyl)butanenitrile |
| SMILES | CC(C)C(C#N)CN1CCCOCC1 |
| InChI | InChI=1S/C11H20N2O/c1-10(2)11(8-12)9-13-4-3-6-14-7-5-13/h10-11H,3-7,9H2,1-2H3 |
| InChIKey | BUJPQJWYQLDJBT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |