C9H17N3O — CID 62974947
2-(methylamino)-3-(1,4-oxazepan-4-yl)propanenitrile (PubChem CID 62974947) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-(methylamino)-3-(1,4-oxazepan-4-yl)propanenitrile.
| Compound Name | 2-(methylamino)-3-(1,4-oxazepan-4-yl)propanenitrile |
|---|---|
| PubChem CID | 62974947 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 2-(methylamino)-3-(1,4-oxazepan-4-yl)propanenitrile |
| SMILES | CNC(C#N)CN1CCCOCC1 |
| InChI | InChI=1S/C9H17N3O/c1-11-9(7-10)8-12-3-2-5-13-6-4-12/h9,11H,2-6,8H2,1H3 |
| InChIKey | JOIQDCPILMZDPL-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |