C11H18N2O — CID 131001556
1-[5-(aminomethyl)-2,4-dimethylpiperidin-1-yl]prop-2-yn-1-one (PubChem CID 131001556) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-[5-(aminomethyl)-2,4-dimethylpiperidin-1-yl]prop-2-yn-1-one.
| Compound Name | 1-[5-(aminomethyl)-2,4-dimethylpiperidin-1-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 131001556 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-[5-(aminomethyl)-2,4-dimethylpiperidin-1-yl]prop-2-yn-1-one |
| SMILES | C#CC(=O)N1CC(CN)C(C)CC1C |
| InChI | InChI=1S/C11H18N2O/c1-4-11(14)13-7-10(6-12)8(2)5-9(13)3/h1,8-10H,5-7,12H2,2-3H3 |
| InChIKey | XLBCJGLJBZOPBB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|