C9H11ClN2O2 — CID 131007244
(3-chloro-4-methylpyrrolidin-1-yl)-(1,2-oxazol-3-yl)methanone (PubChem CID 131007244) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is (3-chloro-4-methylpyrrolidin-1-yl)-(1,2-oxazol-3-yl)methanone.
| Compound Name | (3-chloro-4-methylpyrrolidin-1-yl)-(1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 131007244 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | (3-chloro-4-methylpyrrolidin-1-yl)-(1,2-oxazol-3-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccon2)CC1Cl |
| InChI | InChI=1S/C9H11ClN2O2/c1-6-4-12(5-7(6)10)9(13)8-2-3-14-11-8/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | WCPQZDDJMBAEBV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|