C7H11NS — CID 131007840
trans-(1R,2R)-1-ethyl-2-(isothiocyanatomethyl)cyclopropane (PubChem CID 131007840) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is trans-(1R,2R)-1-ethyl-2-(isothiocyanatomethyl)cyclopropane.
| Compound Name | trans-(1R,2R)-1-ethyl-2-(isothiocyanatomethyl)cyclopropane |
|---|---|
| PubChem CID | 131007840 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | trans-(1R,2R)-1-ethyl-2-(isothiocyanatomethyl)cyclopropane |
| SMILES | CC[C@@H]1C[C@H]1CN=C=S |
| InChI | InChI=1S/C7H11NS/c1-2-6-3-7(6)4-8-5-9/h6-7H,2-4H2,1H3/t6-,7+/m1/s1 |
| InChIKey | NAAQJPMANKFACW-RQJHMYQMSA-N |
| XLogP | 2.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|